C13H27N3O2S2 — CID 80550159
4-(2-methyl-2-piperazin-1-ylpropyl)-3-methylsulfonylthiomorpholine (PubChem CID 80550159) has the molecular formula C13H27N3O2S2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 4-(2-methyl-2-piperazin-1-ylpropyl)-3-methylsulfonylthiomorpholine.
| Compound Name | 4-(2-methyl-2-piperazin-1-ylpropyl)-3-methylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 80550159 |
| Molecular Formula | C13H27N3O2S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-(2-methyl-2-piperazin-1-ylpropyl)-3-methylsulfonylthiomorpholine |
| SMILES | CC(C)(CN1CCSCC1S(C)(=O)=O)N1CCNCC1 |
| InChI | InChI=1S/C13H27N3O2S2/c1-13(2,16-6-4-14-5-7-16)11-15-8-9-19-10-12(15)20(3,17)18/h12,14H,4-11H2,1-3H3 |
| InChIKey | SAQIOEYUQLSGAV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |