C11H23NO3S2 — CID 66381855
2-methyl-2-[(3-methylsulfonylthiomorpholin-4-yl)methyl]butan-1-ol (PubChem CID 66381855) has the molecular formula C11H23NO3S2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-methyl-2-[(3-methylsulfonylthiomorpholin-4-yl)methyl]butan-1-ol.
| Compound Name | 2-methyl-2-[(3-methylsulfonylthiomorpholin-4-yl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 66381855 |
| Molecular Formula | C11H23NO3S2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-methyl-2-[(3-methylsulfonylthiomorpholin-4-yl)methyl]butan-1-ol |
| SMILES | CCC(C)(CO)CN1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C11H23NO3S2/c1-4-11(2,9-13)8-12-5-6-16-7-10(12)17(3,14)15/h10,13H,4-9H2,1-3H3 |
| InChIKey | NSJXQDJMASFYEB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |