C9H17NO5S2 — CID 66382213
2-hydroxy-2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanoic acid (PubChem CID 66382213) has the molecular formula C9H17NO5S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 66382213 |
| Molecular Formula | C9H17NO5S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(3-methylsulfonylthiomorpholin-4-yl)propanoic acid |
| SMILES | CC(O)(CN1CCSCC1S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H17NO5S2/c1-9(13,8(11)12)6-10-3-4-16-5-7(10)17(2,14)15/h7,13H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | GXDJBWBKORLPDA-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |