C14H20IN3OS — CID 80553930
[3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone (PubChem CID 80553930) has the molecular formula C14H20IN3OS and a molecular weight of 405.31 g/mol. Its IUPAC name is [3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone.
| Compound Name | [3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 80553930 |
| Molecular Formula | C14H20IN3OS |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
| SMILES | NC1CCN(C2CCN(C(=O)c3csc(I)c3)C2)CC1 |
| InChI | InChI=1S/C14H20IN3OS/c15-13-7-10(9-20-13)14(19)18-6-3-12(8-18)17-4-1-11(16)2-5-17/h7,9,11-12H,1-6,8,16H2 |
| InChIKey | PDKUIOUIPNFENF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|