C15H11FN2O2S — CID 80554638
4-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoic acid (PubChem CID 80554638) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoic acid.
| Compound Name | 4-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 80554638 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1ccc(F)c(SCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C15H11FN2O2S/c16-12-5-4-10(15(19)20)7-13(12)21-9-11-8-18-6-2-1-3-14(18)17-11/h1-8H,9H2,(H,19,20) |
| InChIKey | BLNLGVHNURUSMO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |