C17H23NO2 — CID 80566401
1-(2-ethylcyclohexyl)-2,3-dihydroindole-3-carboxylic acid (PubChem CID 80566401) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(2-ethylcyclohexyl)-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-(2-ethylcyclohexyl)-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 80566401 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-(2-ethylcyclohexyl)-2,3-dihydroindole-3-carboxylic acid |
| SMILES | CCC1CCCCC1N1CC(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C17H23NO2/c1-2-12-7-3-5-9-15(12)18-11-14(17(19)20)13-8-4-6-10-16(13)18/h4,6,8,10,12,14-15H,2-3,5,7,9,11H2,1H3,(H,19,20) |
| InChIKey | OIZYQNOOCFKKTC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |