C19H28N2 — CID 80574822
3-[2-(2-cyclopentylpyrrolidin-1-yl)ethyl]-2,3-dihydro-1H-indole (PubChem CID 80574822) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 3-[2-(2-cyclopentylpyrrolidin-1-yl)ethyl]-2,3-dihydro-1H-indole.
| Compound Name | 3-[2-(2-cyclopentylpyrrolidin-1-yl)ethyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 80574822 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 3-[2-(2-cyclopentylpyrrolidin-1-yl)ethyl]-2,3-dihydro-1H-indole |
| SMILES | c1ccc2c(c1)NCC2CCN1CCCC1C1CCCC1 |
| InChI | InChI=1S/C19H28N2/c1-2-7-15(6-1)19-10-5-12-21(19)13-11-16-14-20-18-9-4-3-8-17(16)18/h3-4,8-9,15-16,19-20H,1-2,5-7,10-14H2 |
| InChIKey | CWBPPVLWYKKLGP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |