C16H24N2 — CID 80566561
3-[(2-methylazepan-1-yl)methyl]-2,3-dihydro-1H-indole (PubChem CID 80566561) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-[(2-methylazepan-1-yl)methyl]-2,3-dihydro-1H-indole.
| Compound Name | 3-[(2-methylazepan-1-yl)methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 80566561 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-[(2-methylazepan-1-yl)methyl]-2,3-dihydro-1H-indole |
| SMILES | CC1CCCCCN1CC1CNc2ccccc21 |
| InChI | InChI=1S/C16H24N2/c1-13-7-3-2-6-10-18(13)12-14-11-17-16-9-5-4-8-15(14)16/h4-5,8-9,13-14,17H,2-3,6-7,10-12H2,1H3 |
| InChIKey | ZXKWCCGIZYKDPJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |