C13H18N2S — CID 80567140
4-(2,3-dihydro-1H-indol-3-ylmethyl)thiomorpholine (PubChem CID 80567140) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-3-ylmethyl)thiomorpholine.
| Compound Name | 4-(2,3-dihydro-1H-indol-3-ylmethyl)thiomorpholine |
|---|---|
| PubChem CID | 80567140 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-3-ylmethyl)thiomorpholine |
| SMILES | c1ccc2c(c1)NCC2CN1CCSCC1 |
| InChI | InChI=1S/C13H18N2S/c1-2-4-13-12(3-1)11(9-14-13)10-15-5-7-16-8-6-15/h1-4,11,14H,5-10H2 |
| InChIKey | WVYIYUYEOCPSRR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |