C15H22N2O2 — CID 103534870
3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2,3-dihydro-1H-indole (PubChem CID 103534870) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2,3-dihydro-1H-indole.
| Compound Name | 3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 103534870 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2,3-dihydro-1H-indole |
| SMILES | COC1CN(CC2CNc3ccccc32)CC1OC |
| InChI | InChI=1S/C15H22N2O2/c1-18-14-9-17(10-15(14)19-2)8-11-7-16-13-6-4-3-5-12(11)13/h3-6,11,14-16H,7-10H2,1-2H3 |
| InChIKey | ZZVKZSHBNVCBHH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |