C12H21NS — CID 80584362
1,1-dicyclopropyl-N-(thiolan-2-ylmethyl)methanamine (PubChem CID 80584362) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 1,1-dicyclopropyl-N-(thiolan-2-ylmethyl)methanamine.
| Compound Name | 1,1-dicyclopropyl-N-(thiolan-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 80584362 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1,1-dicyclopropyl-N-(thiolan-2-ylmethyl)methanamine |
| SMILES | C1CSC(CNC(C2CC2)C2CC2)C1 |
| InChI | InChI=1S/C12H21NS/c1-2-11(14-7-1)8-13-12(9-3-4-9)10-5-6-10/h9-13H,1-8H2 |
| InChIKey | XERDKOMMPNKRRB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |