C15H23N3O — CID 80601371
4-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)cyclopent-2-en-1-amine (PubChem CID 80601371) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 80601371 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 4-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(c2nc(C3CCCCCCC3)no2)C1 |
| InChI | InChI=1S/C15H23N3O/c16-13-9-8-12(10-13)15-17-14(18-19-15)11-6-4-2-1-3-5-7-11/h8-9,11-13H,1-7,10,16H2 |
| InChIKey | ZJGUDTRFMKTTJF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|