About 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine (PubChem CID 80606144) has the molecular formula C7H12ClN3S2
and a molecular weight of 237.78 g/mol. Its IUPAC name is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine |
| PubChem CID | 80606144 |
| Molecular Formula | C7H12ClN3S2 |
| Molecular Weight | 237.78 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCSCc1nnc(Cl)s1 |
| InChI | InChI=1S/C7H12ClN3S2/c1-11(2)3-4-12-5-6-9-10-7(8)13-6/h3-5H2,1-2H3 |
| InChIKey | MCCTWOCIOGQUFA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.78 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine (CID 80606144) is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine is CN(C)CCSCc1nnc(Cl)s1.
What is the InChIKey of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
The InChIKey is MCCTWOCIOGQUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClN3S2/c1-11(2)3-4-12-5-6-9-10-7(8)13-6/h3-5H2,1-2H3.
What are the key properties of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine has a molecular weight of 237.78 g/mol, XLogP of 1.99, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-dimethylethanamine is sourced from PubChem (CID 80606144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).