C10H9ClN2O2S — CID 80609217
2-chloro-5-[(2-methoxyphenoxy)methyl]-1,3,4-thiadiazole (PubChem CID 80609217) has the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. Its IUPAC name is 2-chloro-5-[(2-methoxyphenoxy)methyl]-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-[(2-methoxyphenoxy)methyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80609217 |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-chloro-5-[(2-methoxyphenoxy)methyl]-1,3,4-thiadiazole |
| SMILES | COc1ccccc1OCc1nnc(Cl)s1 |
| InChI | InChI=1S/C10H9ClN2O2S/c1-14-7-4-2-3-5-8(7)15-6-9-12-13-10(11)16-9/h2-5H,6H2,1H3 |
| InChIKey | UETALUKYGZHKGQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |