C11H11ClN2O3S — CID 80611058
2-chloro-5-[(2,6-dimethoxyphenoxy)methyl]-1,3,4-thiadiazole (PubChem CID 80611058) has the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. Its IUPAC name is 2-chloro-5-[(2,6-dimethoxyphenoxy)methyl]-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-[(2,6-dimethoxyphenoxy)methyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80611058 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-chloro-5-[(2,6-dimethoxyphenoxy)methyl]-1,3,4-thiadiazole |
| SMILES | COc1cccc(OC)c1OCc1nnc(Cl)s1 |
| InChI | InChI=1S/C11H11ClN2O3S/c1-15-7-4-3-5-8(16-2)10(7)17-6-9-13-14-11(12)18-9/h3-5H,6H2,1-2H3 |
| InChIKey | YOKFQTPXIPJVRH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |