C13H9ClN2OS — CID 80609998
2-chloro-5-(naphthalen-2-yloxymethyl)-1,3,4-thiadiazole (PubChem CID 80609998) has the molecular formula C13H9ClN2OS and a molecular weight of 276.75 g/mol. Its IUPAC name is 2-chloro-5-(naphthalen-2-yloxymethyl)-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-(naphthalen-2-yloxymethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80609998 |
| Molecular Formula | C13H9ClN2OS |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-chloro-5-(naphthalen-2-yloxymethyl)-1,3,4-thiadiazole |
| SMILES | Clc1nnc(COc2ccc3ccccc3c2)s1 |
| InChI | InChI=1S/C13H9ClN2OS/c14-13-16-15-12(18-13)8-17-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| InChIKey | XXTGGZWKTQGTAS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |