C8H6ClIN4OS — CID 80610700
3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one (PubChem CID 80610700) has the molecular formula C8H6ClIN4OS and a molecular weight of 368.59 g/mol. Its IUPAC name is 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one.
| Compound Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 80610700 |
| Molecular Formula | C8H6ClIN4OS |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 367.90 |
| IUPAC Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(Cc2nnc(Cl)s2)c(=O)c1I |
| InChI | InChI=1S/C8H6ClIN4OS/c1-4-6(10)7(15)14(3-11-4)2-5-12-13-8(9)16-5/h3H,2H2,1H3 |
| InChIKey | GDKXFIPVMXBITD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|