C16H20N2O2S — CID 80611927
4-(2-cyclooctyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid (PubChem CID 80611927) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 4-(2-cyclooctyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(2-cyclooctyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 80611927 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(2-cyclooctyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2csc(C3CCCCCCC3)n2)c[nH]1 |
| InChI | InChI=1S/C16H20N2O2S/c19-16(20)13-8-12(9-17-13)14-10-21-15(18-14)11-6-4-2-1-3-5-7-11/h8-11,17H,1-7H2,(H,19,20) |
| InChIKey | GGYHTMOEAHYFMC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |