C15H29N3OS — CID 80623930
2-methyl-N-[(5-octan-2-yloxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine (PubChem CID 80623930) has the molecular formula C15H29N3OS and a molecular weight of 299.48 g/mol. Its IUPAC name is 2-methyl-N-[(5-octan-2-yloxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[(5-octan-2-yloxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80623930 |
| Molecular Formula | C15H29N3OS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-methyl-N-[(5-octan-2-yloxy-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCCCCC(C)Oc1nnc(CNCC(C)C)s1 |
| InChI | InChI=1S/C15H29N3OS/c1-5-6-7-8-9-13(4)19-15-18-17-14(20-15)11-16-10-12(2)3/h12-13,16H,5-11H2,1-4H3 |
| InChIKey | JRKGUXXFIODPFZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|