C12H19N3S — CID 80636713
N-[[2-(thian-2-yl)pyrimidin-5-yl]methyl]ethanamine (PubChem CID 80636713) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is N-[[2-(thian-2-yl)pyrimidin-5-yl]methyl]ethanamine.
| Compound Name | N-[[2-(thian-2-yl)pyrimidin-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 80636713 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-[[2-(thian-2-yl)pyrimidin-5-yl]methyl]ethanamine |
| SMILES | CCNCc1cnc(C2CCCCS2)nc1 |
| InChI | InChI=1S/C12H19N3S/c1-2-13-7-10-8-14-12(15-9-10)11-5-3-4-6-16-11/h8-9,11,13H,2-7H2,1H3 |
| InChIKey | HNADATBLAYWAKH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |