C12H8ClFN2OS2 — CID 80645059
N-(2-carbamothioyl-3-fluorophenyl)-3-chlorothiophene-2-carboxamide (PubChem CID 80645059) has the molecular formula C12H8ClFN2OS2 and a molecular weight of 314.79 g/mol. Its IUPAC name is N-(2-carbamothioyl-3-fluorophenyl)-3-chlorothiophene-2-carboxamide.
| Compound Name | N-(2-carbamothioyl-3-fluorophenyl)-3-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80645059 |
| Molecular Formula | C12H8ClFN2OS2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | N-(2-carbamothioyl-3-fluorophenyl)-3-chlorothiophene-2-carboxamide |
| SMILES | NC(=S)c1c(F)cccc1NC(=O)c1sccc1Cl |
| InChI | InChI=1S/C12H8ClFN2OS2/c13-6-4-5-19-10(6)12(17)16-8-3-1-2-7(14)9(8)11(15)18/h1-5H,(H2,15,18)(H,16,17) |
| InChIKey | YFAFRHWAXDKZCM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|