C13H21FN2O3S — CID 80645577
5-amino-N-(2-ethyl-2-hydroxybutyl)-2-fluoro-3-methylbenzenesulfonamide (PubChem CID 80645577) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-amino-N-(2-ethyl-2-hydroxybutyl)-2-fluoro-3-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2-ethyl-2-hydroxybutyl)-2-fluoro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 80645577 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-amino-N-(2-ethyl-2-hydroxybutyl)-2-fluoro-3-methylbenzenesulfonamide |
| SMILES | CCC(O)(CC)CNS(=O)(=O)c1cc(N)cc(C)c1F |
| InChI | InChI=1S/C13H21FN2O3S/c1-4-13(17,5-2)8-16-20(18,19)11-7-10(15)6-9(3)12(11)14/h6-7,16-17H,4-5,8,15H2,1-3H3 |
| InChIKey | OEHWGGCQBHGGFX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|