C16H16ClN3O — CID 80650015
2-chloro-4-(2,3-dihydro-1H-indol-7-ylmethylamino)benzamide (PubChem CID 80650015) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 2-chloro-4-(2,3-dihydro-1H-indol-7-ylmethylamino)benzamide.
| Compound Name | 2-chloro-4-(2,3-dihydro-1H-indol-7-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 80650015 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-chloro-4-(2,3-dihydro-1H-indol-7-ylmethylamino)benzamide |
| SMILES | NC(=O)c1ccc(NCc2cccc3c2NCC3)cc1Cl |
| InChI | InChI=1S/C16H16ClN3O/c17-14-8-12(4-5-13(14)16(18)21)20-9-11-3-1-2-10-6-7-19-15(10)11/h1-5,8,19-20H,6-7,9H2,(H2,18,21) |
| InChIKey | AYTAFQONPJGYGY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |