C15H22N2 — CID 80650268
N-(2,3-dihydro-1H-indol-7-ylmethyl)cyclohexanamine (PubChem CID 80650268) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)cyclohexanamine.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)cyclohexanamine |
|---|---|
| PubChem CID | 80650268 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)cyclohexanamine |
| SMILES | c1cc2c(c(CNC3CCCCC3)c1)NCC2 |
| InChI | InChI=1S/C15H22N2/c1-2-7-14(8-3-1)17-11-13-6-4-5-12-9-10-16-15(12)13/h4-6,14,16-17H,1-3,7-11H2 |
| InChIKey | HDHYFUNKAMZHLQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |