C11H13N3O4S2 — CID 80656279
4-[2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80656279) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-[2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80656279 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-[2-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NC(=O)C2CSC(=O)N2)n1 |
| InChI | InChI=1S/C11H13N3O4S2/c15-8(16)3-1-2-6-4-19-10(12-6)14-9(17)7-5-20-11(18)13-7/h4,7H,1-3,5H2,(H,13,18)(H,15,16)(H,12,14,17) |
| InChIKey | NIEVFGPRAITZDM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|