C14H18BrNOS — CID 80661402
N-(2-bromoethyl)-N-propyl-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 80661402) has the molecular formula C14H18BrNOS and a molecular weight of 328.28 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-propyl-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-propyl-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80661402 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-(2-bromoethyl)-N-propyl-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | CCCN(CCBr)C(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H18BrNOS/c1-2-8-16(9-7-15)14(17)13-10-11-5-3-4-6-12(11)18-13/h3-6,13H,2,7-10H2,1H3 |
| InChIKey | XGVFBEAZLOUKPM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|