C9H9IN2O2S — CID 80662305
4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid (PubChem CID 80662305) has the molecular formula C9H9IN2O2S and a molecular weight of 336.15 g/mol. Its IUPAC name is 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid.
| Compound Name | 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 80662305 |
| Molecular Formula | C9H9IN2O2S |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid |
| SMILES | O=C(O)CCCc1csc2ncc(I)n12 |
| InChI | InChI=1S/C9H9IN2O2S/c10-7-4-11-9-12(7)6(5-15-9)2-1-3-8(13)14/h4-5H,1-3H2,(H,13,14) |
| InChIKey | QEMVJTWFMHISGV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|