4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid

C9H9IN2O2S — CID 80662305

IUPAC4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid
SMILESO=C(O)CCCc1csc2ncc(I)n12
InChIInChI=1S/C9H9IN2O2S/c10-7-4-11-9-12(7)6(5-15-9)2-1-3-8(13)14/h4-5H,1-3H2,(H,13,14)
InChIKeyQEMVJTWFMHISGV-UHFFFAOYSA-N
MW336.15 g/mol
LogP2.41
Rot. Bonds4

About 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid

4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid (PubChem CID 80662305) has the molecular formula C9H9IN2O2S and a molecular weight of 336.15 g/mol. Its IUPAC name is 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid
PubChem CID80662305
Molecular FormulaC9H9IN2O2S
Molecular Weight336.15 g/mol
Exact Mass335.94
IUPAC Name4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid
SMILESO=C(O)CCCc1csc2ncc(I)n12
InChIInChI=1S/C9H9IN2O2S/c10-7-4-11-9-12(7)6(5-15-9)2-1-3-8(13)14/h4-5H,1-3H2,(H,13,14)
InChIKeyQEMVJTWFMHISGV-UHFFFAOYSA-N
XLogP2.41
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.15
LogP ≤ 52.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid?
The IUPAC name of 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid (CID 80662305) is 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid.
What is the SMILES notation for 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid?
The canonical SMILES for 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid is O=C(O)CCCc1csc2ncc(I)n12.
What is the InChIKey of 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid?
The InChIKey is QEMVJTWFMHISGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IN2O2S/c10-7-4-11-9-12(7)6(5-15-9)2-1-3-8(13)14/h4-5H,1-3H2,(H,13,14).
What are the key properties of 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid?
4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid has a molecular weight of 336.15 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-iodoimidazo[2,1-b][1,3]thiazol-3-yl)butanoic acid is sourced from PubChem (CID 80662305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).