About 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine
4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine (PubChem CID 80663995) has the molecular formula C12H18ClN3O
and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine |
| PubChem CID | 80663995 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine |
| SMILES | Cc1cc(Cl)nc(CN2CCOCC2(C)C)n1 |
| InChI | InChI=1S/C12H18ClN3O/c1-9-6-10(13)15-11(14-9)7-16-4-5-17-8-12(16,2)3/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | VLEIJZJJCBBZFM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine?
The IUPAC name of 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine (CID 80663995) is 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine.
What is the SMILES notation for 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine?
The canonical SMILES for 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine is Cc1cc(Cl)nc(CN2CCOCC2(C)C)n1.
What is the InChIKey of 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine?
The InChIKey is VLEIJZJJCBBZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3O/c1-9-6-10(13)15-11(14-9)7-16-4-5-17-8-12(16,2)3/h6H,4-5,7-8H2,1-3H3.
What are the key properties of 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine?
4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine has a molecular weight of 255.75 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-3,3-dimethylmorpholine is sourced from PubChem (CID 80663995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).