C10H16BrN3O2S — CID 80675568
2-(bromomethyl)-1-[(2-methyl-1H-imidazol-5-yl)sulfonyl]piperidine (PubChem CID 80675568) has the molecular formula C10H16BrN3O2S and a molecular weight of 322.23 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[(2-methyl-1H-imidazol-5-yl)sulfonyl]piperidine.
| Compound Name | 2-(bromomethyl)-1-[(2-methyl-1H-imidazol-5-yl)sulfonyl]piperidine |
|---|---|
| PubChem CID | 80675568 |
| Molecular Formula | C10H16BrN3O2S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-(bromomethyl)-1-[(2-methyl-1H-imidazol-5-yl)sulfonyl]piperidine |
| SMILES | Cc1ncc(S(=O)(=O)N2CCCCC2CBr)[nH]1 |
| InChI | InChI=1S/C10H16BrN3O2S/c1-8-12-7-10(13-8)17(15,16)14-5-3-2-4-9(14)6-11/h7,9H,2-6H2,1H3,(H,12,13) |
| InChIKey | MTPCETCUJQVVQS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|