C20H32N2O — CID 806803
1-[(4-ethoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine (PubChem CID 806803) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine |
|---|---|
| PubChem CID | 806803 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-4-[(3R)-3-methylpiperidin-1-yl]piperidine |
| SMILES | CCOc1ccc(CN2CCC(N3CCC[C@@H](C)C3)CC2)cc1 |
| InChI | InChI=1S/C20H32N2O/c1-3-23-20-8-6-18(7-9-20)16-21-13-10-19(11-14-21)22-12-4-5-17(2)15-22/h6-9,17,19H,3-5,10-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | YTKFWXBFVGRGTA-QGZVFWFLSA-N |
| XLogP | 3.78 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |