C13H17BrN4O — CID 80682321
N-[(2-bromo-5-methoxyphenyl)methyl]-2-(1-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 80682321) has the molecular formula C13H17BrN4O and a molecular weight of 325.21 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxyphenyl)methyl]-2-(1-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[(2-bromo-5-methoxyphenyl)methyl]-2-(1-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 80682321 |
| Molecular Formula | C13H17BrN4O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-[(2-bromo-5-methoxyphenyl)methyl]-2-(1-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | COc1ccc(Br)c(CNCCc2ncn(C)n2)c1 |
| InChI | InChI=1S/C13H17BrN4O/c1-18-9-16-13(17-18)5-6-15-8-10-7-11(19-2)3-4-12(10)14/h3-4,7,9,15H,5-6,8H2,1-2H3 |
| InChIKey | IHRSZCGHQRXKNV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|