C13H14N4O3S — CID 80684647
(E)-3-[5-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 80684647) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is (E)-3-[5-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80684647 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (E)-3-[5-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cn1cnc(CCNC(=O)c2ccc(/C=C/C(=O)O)s2)n1 |
| InChI | InChI=1S/C13H14N4O3S/c1-17-8-15-11(16-17)6-7-14-13(20)10-4-2-9(21-10)3-5-12(18)19/h2-5,8H,6-7H2,1H3,(H,14,20)(H,18,19)/b5-3+ |
| InChIKey | BGQXGGQLUZEKOE-HWKANZROSA-N |
| XLogP | 0.95 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|