C10H16Cl2N2OS — CID 80687134
4-chloro-5-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-1,3-thiazol-2-amine (PubChem CID 80687134) has the molecular formula C10H16Cl2N2OS and a molecular weight of 283.22 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-5-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 80687134 |
| Molecular Formula | C10H16Cl2N2OS |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCOCCN(CC)c1nc(Cl)c(CCl)s1 |
| InChI | InChI=1S/C10H16Cl2N2OS/c1-3-14(5-6-15-4-2)10-13-9(12)8(7-11)16-10/h3-7H2,1-2H3 |
| InChIKey | NTDZNHZSDOTKGF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|