C13H20BrNS — CID 80690784
2-(3-bromopropyl)-1-(2-thiophen-2-ylethyl)pyrrolidine (PubChem CID 80690784) has the molecular formula C13H20BrNS and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-(3-bromopropyl)-1-(2-thiophen-2-ylethyl)pyrrolidine.
| Compound Name | 2-(3-bromopropyl)-1-(2-thiophen-2-ylethyl)pyrrolidine |
|---|---|
| PubChem CID | 80690784 |
| Molecular Formula | C13H20BrNS |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(3-bromopropyl)-1-(2-thiophen-2-ylethyl)pyrrolidine |
| SMILES | BrCCCC1CCCN1CCc1cccs1 |
| InChI | InChI=1S/C13H20BrNS/c14-8-1-4-12-5-2-9-15(12)10-7-13-6-3-11-16-13/h3,6,11-12H,1-2,4-5,7-10H2 |
| InChIKey | SXWULUHIRJAANZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|