C10H15ClN2OS — CID 80692094
[4-chloro-2-[ethyl(2-methylprop-2-enyl)amino]-1,3-thiazol-5-yl]methanol (PubChem CID 80692094) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is [4-chloro-2-[ethyl(2-methylprop-2-enyl)amino]-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-chloro-2-[ethyl(2-methylprop-2-enyl)amino]-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 80692094 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [4-chloro-2-[ethyl(2-methylprop-2-enyl)amino]-1,3-thiazol-5-yl]methanol |
| SMILES | C=C(C)CN(CC)c1nc(Cl)c(CO)s1 |
| InChI | InChI=1S/C10H15ClN2OS/c1-4-13(5-7(2)3)10-12-9(11)8(6-14)15-10/h14H,2,4-6H2,1,3H3 |
| InChIKey | QIYAAFHMMOAVTH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|