C15H28N2O4 — CID 80703334
methyl 2-[[2-(4-hydroxy-4-methylpiperidin-1-yl)acetyl]amino]-3-methylpentanoate (PubChem CID 80703334) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 2-[[2-(4-hydroxy-4-methylpiperidin-1-yl)acetyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[2-(4-hydroxy-4-methylpiperidin-1-yl)acetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 80703334 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | methyl 2-[[2-(4-hydroxy-4-methylpiperidin-1-yl)acetyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)CN1CCC(C)(O)CC1)C(=O)OC |
| InChI | InChI=1S/C15H28N2O4/c1-5-11(2)13(14(19)21-4)16-12(18)10-17-8-6-15(3,20)7-9-17/h11,13,20H,5-10H2,1-4H3,(H,16,18) |
| InChIKey | VVZWJMOVDQPWAK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |