C16H13NOS2 — CID 80708496
N-(3-ethynylphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 80708496) has the molecular formula C16H13NOS2 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 80708496 |
| Molecular Formula | C16H13NOS2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2cc3c(s2)CCSC3)c1 |
| InChI | InChI=1S/C16H13NOS2/c1-2-11-4-3-5-13(8-11)17-16(18)15-9-12-10-19-7-6-14(12)20-15/h1,3-5,8-9H,6-7,10H2,(H,17,18) |
| InChIKey | SFQTWELSRPGJDV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|