C14H15FN2OS — CID 80709860
N-(2-cyano-4-fluorophenyl)-2-(thian-4-yl)acetamide (PubChem CID 80709860) has the molecular formula C14H15FN2OS and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(2-cyano-4-fluorophenyl)-2-(thian-4-yl)acetamide.
| Compound Name | N-(2-cyano-4-fluorophenyl)-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 80709860 |
| Molecular Formula | C14H15FN2OS |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(2-cyano-4-fluorophenyl)-2-(thian-4-yl)acetamide |
| SMILES | N#Cc1cc(F)ccc1NC(=O)CC1CCSCC1 |
| InChI | InChI=1S/C14H15FN2OS/c15-12-1-2-13(11(8-12)9-16)17-14(18)7-10-3-5-19-6-4-10/h1-2,8,10H,3-7H2,(H,17,18) |
| InChIKey | AYJRWWLEOZYLKP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |