C13H10ClN5O — CID 80709861
2-chloro-N-(2-methyl-1,2,4-triazol-3-yl)quinoline-4-carboxamide (PubChem CID 80709861) has the molecular formula C13H10ClN5O and a molecular weight of 287.71 g/mol. Its IUPAC name is 2-chloro-N-(2-methyl-1,2,4-triazol-3-yl)quinoline-4-carboxamide.
| Compound Name | 2-chloro-N-(2-methyl-1,2,4-triazol-3-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 80709861 |
| Molecular Formula | C13H10ClN5O |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-chloro-N-(2-methyl-1,2,4-triazol-3-yl)quinoline-4-carboxamide |
| SMILES | Cn1ncnc1NC(=O)c1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C13H10ClN5O/c1-19-13(15-7-16-19)18-12(20)9-6-11(14)17-10-5-3-2-4-8(9)10/h2-7H,1H3,(H,15,16,18,20) |
| InChIKey | KQWQKMAHAMNURT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|