C13H13N6O+ — CID 154679292
2-methyl-N-(2-methyl-1,2,4-triazol-3-yl)cinnolin-2-ium-4-carboxamide (PubChem CID 154679292) has the molecular formula C13H13N6O+ and a molecular weight of 269.29 g/mol. Its IUPAC name is 2-methyl-N-(2-methyl-1,2,4-triazol-3-yl)cinnolin-2-ium-4-carboxamide.
| Compound Name | 2-methyl-N-(2-methyl-1,2,4-triazol-3-yl)cinnolin-2-ium-4-carboxamide |
|---|---|
| PubChem CID | 154679292 |
| Molecular Formula | C13H13N6O+ |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-methyl-N-(2-methyl-1,2,4-triazol-3-yl)cinnolin-2-ium-4-carboxamide |
| SMILES | Cn1ncnc1NC(=O)c1c[n+](C)nc2ccccc12 |
| InChI | InChI=1S/C13H12N6O/c1-18-7-10(9-5-3-4-6-11(9)17-18)12(20)16-13-14-8-15-19(13)2/h3-8H,1-2H3/p+1 |
| InChIKey | DOEZPPSFDCOEGL-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|