C10H15ClN2O3 — CID 80719423
3-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)propanamide (PubChem CID 80719423) has the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. Its IUPAC name is 3-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)propanamide.
| Compound Name | 3-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 80719423 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)propanamide |
| SMILES | O=C(CCCl)NC(=O)NC1CC2CCC1O2 |
| InChI | InChI=1S/C10H15ClN2O3/c11-4-3-9(14)13-10(15)12-7-5-6-1-2-8(7)16-6/h6-8H,1-5H2,(H2,12,13,14,15) |
| InChIKey | RRMQIGLJPPFJJW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|