C15H17NO3S2 — CID 80722552
2-[1-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexyl]acetic acid (PubChem CID 80722552) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[1-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexyl]acetic acid.
| Compound Name | 2-[1-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 80722552 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[1-(thieno[3,2-b]thiophene-5-carbonylamino)cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cc3sccc3s2)CCCCC1 |
| InChI | InChI=1S/C15H17NO3S2/c17-13(18)9-15(5-2-1-3-6-15)16-14(19)12-8-11-10(21-12)4-7-20-11/h4,7-8H,1-3,5-6,9H2,(H,16,19)(H,17,18) |
| InChIKey | OYPDQHKTJIJZJM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |