C14H12Cl3N3O — CID 80726063
4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]-2-methylpyrimidine-5-carbaldehyde (PubChem CID 80726063) has the molecular formula C14H12Cl3N3O and a molecular weight of 344.63 g/mol. Its IUPAC name is 4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]-2-methylpyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]-2-methylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 80726063 |
| Molecular Formula | C14H12Cl3N3O |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]-2-methylpyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(NCCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H12Cl3N3O/c1-8-19-13(17)11(7-21)14(20-8)18-5-4-9-2-3-10(15)6-12(9)16/h2-3,6-7H,4-5H2,1H3,(H,18,19,20) |
| InChIKey | GDQZCUZRTCKGHZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|