C13H10Cl3N3O — CID 86615710
4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]pyrimidine-2-carbaldehyde (PubChem CID 86615710) has the molecular formula C13H10Cl3N3O and a molecular weight of 330.60 g/mol. Its IUPAC name is 4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]pyrimidine-2-carbaldehyde.
| Compound Name | 4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 86615710 |
| Molecular Formula | C13H10Cl3N3O |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 4-chloro-6-[2-(2,4-dichlorophenyl)ethylamino]pyrimidine-2-carbaldehyde |
| SMILES | O=Cc1nc(Cl)cc(NCCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H10Cl3N3O/c14-9-2-1-8(10(15)5-9)3-4-17-12-6-11(16)18-13(7-20)19-12/h1-2,5-7H,3-4H2,(H,17,18,19) |
| InChIKey | GGCSVVPSLAYWGU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|