C14H15NO3S2 — CID 80729994
4-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 80729994) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 80729994 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 4-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | COc1cc(N)ccc1SCc1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C14H15NO3S2/c1-8-9(5-13(20-8)14(16)17)7-19-12-4-3-10(15)6-11(12)18-2/h3-6H,7,15H2,1-2H3,(H,16,17) |
| InChIKey | CLYKRNRZPHLAAN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|