C13H13NO2S2 — CID 80730790
4-[(4-aminophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 80730790) has the molecular formula C13H13NO2S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-[(4-aminophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(4-aminophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 80730790 |
| Molecular Formula | C13H13NO2S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 4-[(4-aminophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CSc1ccc(N)cc1 |
| InChI | InChI=1S/C13H13NO2S2/c1-8-9(6-12(18-8)13(15)16)7-17-11-4-2-10(14)3-5-11/h2-6H,7,14H2,1H3,(H,15,16) |
| InChIKey | KEOVVVUXMDMLJN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|