C13H11FO2S2 — CID 80730086
4-[(3-fluorophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 80730086) has the molecular formula C13H11FO2S2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(3-fluorophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 80730086 |
| Molecular Formula | C13H11FO2S2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 4-[(3-fluorophenyl)sulfanylmethyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CSc1cccc(F)c1 |
| InChI | InChI=1S/C13H11FO2S2/c1-8-9(5-12(18-8)13(15)16)7-17-11-4-2-3-10(14)6-11/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | VZMTVYDKGNSIFI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |