C12H19N3O4S2 — CID 80731135
5-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-N-ethyl-3-nitrothiophen-2-amine (PubChem CID 80731135) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 5-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-N-ethyl-3-nitrothiophen-2-amine.
| Compound Name | 5-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-N-ethyl-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 80731135 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-N-ethyl-3-nitrothiophen-2-amine |
| SMILES | CCNc1sc(S(=O)(=O)N2CCCC2(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N3O4S2/c1-4-13-11-9(15(16)17)8-10(20-11)21(18,19)14-7-5-6-12(14,2)3/h8,13H,4-7H2,1-3H3 |
| InChIKey | NPHMUKQTVVFLRT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|