C10H10N4O4S3 — CID 80731451
5-amino-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80731451) has the molecular formula C10H10N4O4S3 and a molecular weight of 346.42 g/mol. Its IUPAC name is 5-amino-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80731451 |
| Molecular Formula | C10H10N4O4S3 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 5-amino-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-4-nitrothiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)Nc2nc3c(s2)CCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O4S3/c11-9-6(14(15)16)4-8(20-9)21(17,18)13-10-12-5-2-1-3-7(5)19-10/h4H,1-3,11H2,(H,12,13) |
| InChIKey | XJCDFVAMOOLOHS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|