C10H17N3O4S2 — CID 80746593
5-amino-N-ethyl-N-(2-methylpropyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80746593) has the molecular formula C10H17N3O4S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-amino-N-ethyl-N-(2-methylpropyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-ethyl-N-(2-methylpropyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80746593 |
| Molecular Formula | C10H17N3O4S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-amino-N-ethyl-N-(2-methylpropyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | CCN(CC(C)C)S(=O)(=O)c1cc([N+](=O)[O-])c(N)s1 |
| InChI | InChI=1S/C10H17N3O4S2/c1-4-12(6-7(2)3)19(16,17)9-5-8(13(14)15)10(11)18-9/h5,7H,4,6,11H2,1-3H3 |
| InChIKey | HVUZRJKQPOUJSB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|